C14H19NO4 — CID 67428325
(E)-2-methylpent-2-enoic acid;4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 67428325) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (E)-2-methylpent-2-enoic acid;4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | (E)-2-methylpent-2-enoic acid;4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 67428325 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (E)-2-methylpent-2-enoic acid;4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | CC/C=C(\C)C(=O)O.O=C1NC(=O)C2=C1CCCC2 |
| InChI | InChI=1S/C8H9NO2.C6H10O2/c10-7-5-3-1-2-4-6(5)8(11)9-7;1-3-4-5(2)6(7)8/h1-4H2,(H,9,10,11);4H,3H2,1-2H3,(H,7,8)/b;5-4+ |
| InChIKey | MUHFYIPVRFWKFO-RCKHEGBHSA-N |
| XLogP | 1.94 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|