About methyl 2-carbamoyl-1-[3-(2,4-difluoro-3-pyridinyl)phenyl]imidazole-4-carboxylate
methyl 2-carbamoyl-1-[3-(2,4-difluoro-3-pyridinyl)phenyl]imidazole-4-carboxylate (PubChem CID 67428516) has the molecular formula C17H12F2N4O3
and a molecular weight of 358.30 g/mol. Its IUPAC name is methyl 2-carbamoyl-1-[3-(2,4-difluoro-3-pyridinyl)phenyl]imidazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-carbamoyl-1-[3-(2,4-difluoro-3-pyridinyl)phenyl]imidazole-4-carboxylate |
| PubChem CID | 67428516 |
| Molecular Formula | C17H12F2N4O3 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | methyl 2-carbamoyl-1-[3-(2,4-difluoro-3-pyridinyl)phenyl]imidazole-4-carboxylate |
| SMILES | COC(=O)c1cn(-c2cccc(-c3c(F)ccnc3F)c2)c(C(N)=O)n1 |
| InChI | InChI=1S/C17H12F2N4O3/c1-26-17(25)12-8-23(16(22-12)15(20)24)10-4-2-3-9(7-10)13-11(18)5-6-21-14(13)19/h2-8H,1H3,(H2,20,24) |
| InChIKey | WCVTUYHEUNHTLE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-carbamoyl-1-[3-(2,4-difluoro-3-pyridinyl)phenyl]imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-carbamoyl-1-[3-(2,4-difluoro-3-pyridinyl)phenyl]imidazole-4-carboxylate?
The IUPAC name of methyl 2-carbamoyl-1-[3-(2,4-difluoro-3-pyridinyl)phenyl]imidazole-4-carboxylate (CID 67428516) is methyl 2-carbamoyl-1-[3-(2,4-difluoro-3-pyridinyl)phenyl]imidazole-4-carboxylate.
What is the SMILES notation for methyl 2-carbamoyl-1-[3-(2,4-difluoro-3-pyridinyl)phenyl]imidazole-4-carboxylate?
The canonical SMILES for methyl 2-carbamoyl-1-[3-(2,4-difluoro-3-pyridinyl)phenyl]imidazole-4-carboxylate is COC(=O)c1cn(-c2cccc(-c3c(F)ccnc3F)c2)c(C(N)=O)n1.
What is the InChIKey of methyl 2-carbamoyl-1-[3-(2,4-difluoro-3-pyridinyl)phenyl]imidazole-4-carboxylate?
The InChIKey is WCVTUYHEUNHTLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F2N4O3/c1-26-17(25)12-8-23(16(22-12)15(20)24)10-4-2-3-9(7-10)13-11(18)5-6-21-14(13)19/h2-8H,1H3,(H2,20,24).
What are the key properties of methyl 2-carbamoyl-1-[3-(2,4-difluoro-3-pyridinyl)phenyl]imidazole-4-carboxylate?
methyl 2-carbamoyl-1-[3-(2,4-difluoro-3-pyridinyl)phenyl]imidazole-4-carboxylate has a molecular weight of 358.30 g/mol, XLogP of 2.10, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-carbamoyl-1-[3-(2,4-difluoro-3-pyridinyl)phenyl]imidazole-4-carboxylate is sourced from PubChem (CID 67428516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).