About 1,2-benzodiazonin-7-one
1,2-benzodiazonin-7-one (PubChem CID 67428589) has the molecular formula C11H8N2O
and a molecular weight of 184.20 g/mol. Its IUPAC name is 1,2-benzodiazonin-7-one.
Molecular Properties
| Compound Name | 1,2-benzodiazonin-7-one |
| PubChem CID | 67428589 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 1,2-benzodiazonin-7-one |
| SMILES | O=C1C=CC=C/N=N\c2ccccc21 |
| InChI | InChI=1S/C11H8N2O/c14-11-7-3-4-8-12-13-10-6-2-1-5-9(10)11/h1-8H/b7-3?,8-4?,13-12- |
| InChIKey | YDCVVJRBQTZZNM-HMDZDXEWSA-N |
| XLogP | 3.04 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-benzodiazonin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-benzodiazonin-7-one?
The IUPAC name of 1,2-benzodiazonin-7-one (CID 67428589) is 1,2-benzodiazonin-7-one.
What is the SMILES notation for 1,2-benzodiazonin-7-one?
The canonical SMILES for 1,2-benzodiazonin-7-one is O=C1C=CC=C/N=N\c2ccccc21.
What is the InChIKey of 1,2-benzodiazonin-7-one?
The InChIKey is YDCVVJRBQTZZNM-HMDZDXEWSA-N. The full InChI is InChI=1S/C11H8N2O/c14-11-7-3-4-8-12-13-10-6-2-1-5-9(10)11/h1-8H/b7-3?,8-4?,13-12-.
What are the key properties of 1,2-benzodiazonin-7-one?
1,2-benzodiazonin-7-one has a molecular weight of 184.20 g/mol, XLogP of 3.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-benzodiazonin-7-one is sourced from PubChem (CID 67428589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).