About 7-pentyl-3,9-diazabicyclo[3.3.1]non-6-ene
7-pentyl-3,9-diazabicyclo[3.3.1]non-6-ene (PubChem CID 67428632) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 7-pentyl-3,9-diazabicyclo[3.3.1]non-6-ene.
Molecular Properties
| Compound Name | 7-pentyl-3,9-diazabicyclo[3.3.1]non-6-ene |
| PubChem CID | 67428632 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 7-pentyl-3,9-diazabicyclo[3.3.1]non-6-ene |
| SMILES | CCCCCC1=CC2CNCC(C1)N2 |
| InChI | InChI=1S/C12H22N2/c1-2-3-4-5-10-6-11-8-13-9-12(7-10)14-11/h6,11-14H,2-5,7-9H2,1H3 |
| InChIKey | WLMSVGRITHQHAM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-pentyl-3,9-diazabicyclo[3.3.1]non-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-pentyl-3,9-diazabicyclo[3.3.1]non-6-ene?
The IUPAC name of 7-pentyl-3,9-diazabicyclo[3.3.1]non-6-ene (CID 67428632) is 7-pentyl-3,9-diazabicyclo[3.3.1]non-6-ene.
What is the SMILES notation for 7-pentyl-3,9-diazabicyclo[3.3.1]non-6-ene?
The canonical SMILES for 7-pentyl-3,9-diazabicyclo[3.3.1]non-6-ene is CCCCCC1=CC2CNCC(C1)N2.
What is the InChIKey of 7-pentyl-3,9-diazabicyclo[3.3.1]non-6-ene?
The InChIKey is WLMSVGRITHQHAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2/c1-2-3-4-5-10-6-11-8-13-9-12(7-10)14-11/h6,11-14H,2-5,7-9H2,1H3.
What are the key properties of 7-pentyl-3,9-diazabicyclo[3.3.1]non-6-ene?
7-pentyl-3,9-diazabicyclo[3.3.1]non-6-ene has a molecular weight of 194.32 g/mol, XLogP of 1.83, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-pentyl-3,9-diazabicyclo[3.3.1]non-6-ene is sourced from PubChem (CID 67428632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).