About 1-(cyclohexa-2,5-dien-1-ylmethoxy)-4-methylpentan-2-one
1-(cyclohexa-2,5-dien-1-ylmethoxy)-4-methylpentan-2-one (PubChem CID 67428703) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(cyclohexa-2,5-dien-1-ylmethoxy)-4-methylpentan-2-one.
Molecular Properties
| Compound Name | 1-(cyclohexa-2,5-dien-1-ylmethoxy)-4-methylpentan-2-one |
| PubChem CID | 67428703 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 1-(cyclohexa-2,5-dien-1-ylmethoxy)-4-methylpentan-2-one |
| SMILES | CC(C)CC(=O)COCC1C=CCC=C1 |
| InChI | InChI=1S/C13H20O2/c1-11(2)8-13(14)10-15-9-12-6-4-3-5-7-12/h4-7,11-12H,3,8-10H2,1-2H3 |
| InChIKey | LPULSLKKSIJIHZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclohexa-2,5-dien-1-ylmethoxy)-4-methylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexa-2,5-dien-1-ylmethoxy)-4-methylpentan-2-one?
The IUPAC name of 1-(cyclohexa-2,5-dien-1-ylmethoxy)-4-methylpentan-2-one (CID 67428703) is 1-(cyclohexa-2,5-dien-1-ylmethoxy)-4-methylpentan-2-one.
What is the SMILES notation for 1-(cyclohexa-2,5-dien-1-ylmethoxy)-4-methylpentan-2-one?
The canonical SMILES for 1-(cyclohexa-2,5-dien-1-ylmethoxy)-4-methylpentan-2-one is CC(C)CC(=O)COCC1C=CCC=C1.
What is the InChIKey of 1-(cyclohexa-2,5-dien-1-ylmethoxy)-4-methylpentan-2-one?
The InChIKey is LPULSLKKSIJIHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2/c1-11(2)8-13(14)10-15-9-12-6-4-3-5-7-12/h4-7,11-12H,3,8-10H2,1-2H3.
What are the key properties of 1-(cyclohexa-2,5-dien-1-ylmethoxy)-4-methylpentan-2-one?
1-(cyclohexa-2,5-dien-1-ylmethoxy)-4-methylpentan-2-one has a molecular weight of 208.30 g/mol, XLogP of 2.75, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexa-2,5-dien-1-ylmethoxy)-4-methylpentan-2-one is sourced from PubChem (CID 67428703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).