C17H14F5N5O3 — CID 67428861
4-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-8,9-difluoro-[1]benzofuro[3,2-d]pyrimidin-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 67428861) has the molecular formula C17H14F5N5O3 and a molecular weight of 431.32 g/mol. Its IUPAC name is 4-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-8,9-difluoro-[1]benzofuro[3,2-d]pyrimidin-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-8,9-difluoro-[1]benzofuro[3,2-d]pyrimidin-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67428861 |
| Molecular Formula | C17H14F5N5O3 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 4-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-8,9-difluoro-[1]benzofuro[3,2-d]pyrimidin-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | Nc1nc(N2CC3CC2CN3)c2oc3ccc(F)c(F)c3c2n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H13F2N5O.C2HF3O2/c16-8-1-2-9-10(11(8)17)12-13(23-9)14(21-15(18)20-12)22-5-6-3-7(22)4-19-6;3-2(4,5)1(6)7/h1-2,6-7,19H,3-5H2,(H2,18,20,21);(H,6,7) |
| InChIKey | YBNOMZOKTFUYQX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |