About 3-[6-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrazol-3-yl]-1H-pyridazin-2-yl]phenol
3-[6-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrazol-3-yl]-1H-pyridazin-2-yl]phenol (PubChem CID 67429050) has the molecular formula C21H18N4O3
and a molecular weight of 374.40 g/mol. Its IUPAC name is 3-[6-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrazol-3-yl]-1H-pyridazin-2-yl]phenol.
Molecular Properties
| Compound Name | 3-[6-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrazol-3-yl]-1H-pyridazin-2-yl]phenol |
| PubChem CID | 67429050 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 3-[6-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrazol-3-yl]-1H-pyridazin-2-yl]phenol |
| SMILES | Oc1cccc(N2C=CC=C(c3ccnn3-c3ccc4c(c3)OCCO4)N2)c1 |
| InChI | InChI=1S/C21H18N4O3/c26-17-4-1-3-15(13-17)24-10-2-5-18(23-24)19-8-9-22-25(19)16-6-7-20-21(14-16)28-12-11-27-20/h1-10,13-14,23,26H,11-12H2 |
| InChIKey | RMOQUXOXTNASCN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[6-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrazol-3-yl]-1H-pyridazin-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrazol-3-yl]-1H-pyridazin-2-yl]phenol?
The IUPAC name of 3-[6-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrazol-3-yl]-1H-pyridazin-2-yl]phenol (CID 67429050) is 3-[6-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrazol-3-yl]-1H-pyridazin-2-yl]phenol.
What is the SMILES notation for 3-[6-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrazol-3-yl]-1H-pyridazin-2-yl]phenol?
The canonical SMILES for 3-[6-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrazol-3-yl]-1H-pyridazin-2-yl]phenol is Oc1cccc(N2C=CC=C(c3ccnn3-c3ccc4c(c3)OCCO4)N2)c1.
What is the InChIKey of 3-[6-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrazol-3-yl]-1H-pyridazin-2-yl]phenol?
The InChIKey is RMOQUXOXTNASCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N4O3/c26-17-4-1-3-15(13-17)24-10-2-5-18(23-24)19-8-9-22-25(19)16-6-7-20-21(14-16)28-12-11-27-20/h1-10,13-14,23,26H,11-12H2.
What are the key properties of 3-[6-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrazol-3-yl]-1H-pyridazin-2-yl]phenol?
3-[6-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrazol-3-yl]-1H-pyridazin-2-yl]phenol has a molecular weight of 374.40 g/mol, XLogP of 3.23, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrazol-3-yl]-1H-pyridazin-2-yl]phenol is sourced from PubChem (CID 67429050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).