C14H15Cl2N3O6 — CID 67429381
N-[1,1-dichloro-3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynyl]acetamide (PubChem CID 67429381) has the molecular formula C14H15Cl2N3O6 and a molecular weight of 392.20 g/mol. Its IUPAC name is N-[1,1-dichloro-3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynyl]acetamide.
| Compound Name | N-[1,1-dichloro-3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynyl]acetamide |
|---|---|
| PubChem CID | 67429381 |
| Molecular Formula | C14H15Cl2N3O6 |
| Molecular Weight | 392.20 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | N-[1,1-dichloro-3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynyl]acetamide |
| SMILES | CC(=O)NC(Cl)(Cl)C#Cc1cc([N+](=O)[O-])n([C@H]2C[C@H](O)[C@@H](CO)O2)c1 |
| InChI | InChI=1S/C14H15Cl2N3O6/c1-8(21)17-14(15,16)3-2-9-4-12(19(23)24)18(6-9)13-5-10(22)11(7-20)25-13/h4,6,10-11,13,20,22H,5,7H2,1H3,(H,17,21)/t10-,11+,13+/m0/s1 |
| InChIKey | XWEBLIAUGOEIKC-DMDPSCGWSA-N |
| XLogP | 0.66 |
| TPSA | 126.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|