C19H20F3N5OS — CID 67430745
3-[[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]methylamino]propan-1-ol (PubChem CID 67430745) has the molecular formula C19H20F3N5OS and a molecular weight of 423.46 g/mol. Its IUPAC name is 3-[[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]methylamino]propan-1-ol.
| Compound Name | 3-[[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]methylamino]propan-1-ol |
|---|---|
| PubChem CID | 67430745 |
| Molecular Formula | C19H20F3N5OS |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 3-[[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]methylamino]propan-1-ol |
| SMILES | Cc1cc(Nc2nccc(C(F)(F)F)n2)cc(-c2cnc(CNCCCO)s2)c1 |
| InChI | InChI=1S/C19H20F3N5OS/c1-12-7-13(15-10-25-17(29-15)11-23-4-2-6-28)9-14(8-12)26-18-24-5-3-16(27-18)19(20,21)22/h3,5,7-10,23,28H,2,4,6,11H2,1H3,(H,24,26,27) |
| InChIKey | WBASWOLWZYFEKR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|