C28H32F3N5O4S — CID 67431121
[(1R,4S)-4-carbamoyl-3,3-dimethyl-1-[5-[3-methyl-5-[(4-propan-2-yloxypyrimidin-2-yl)amino]phenyl]-1,3-thiazol-2-yl]cyclohexyl] 2,2,2-trifluoroacetate (PubChem CID 67431121) has the molecular formula C28H32F3N5O4S and a molecular weight of 591.66 g/mol. Its IUPAC name is [(1R,4S)-4-carbamoyl-3,3-dimethyl-1-[5-[3-methyl-5-[(4-propan-2-yloxypyrimidin-2-yl)amino]phenyl]-1,3-thiazol-2-yl]cyclohexyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1R,4S)-4-carbamoyl-3,3-dimethyl-1-[5-[3-methyl-5-[(4-propan-2-yloxypyrimidin-2-yl)amino]phenyl]-1,3-thiazol-2-yl]cyclohexyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67431121 |
| Molecular Formula | C28H32F3N5O4S |
| Molecular Weight | 591.66 g/mol |
| Exact Mass | 591.21 |
| IUPAC Name | [(1R,4S)-4-carbamoyl-3,3-dimethyl-1-[5-[3-methyl-5-[(4-propan-2-yloxypyrimidin-2-yl)amino]phenyl]-1,3-thiazol-2-yl]cyclohexyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1cc(Nc2nccc(OC(C)C)n2)cc(-c2cnc([C@@]3(OC(=O)C(F)(F)F)CC[C@H](C(N)=O)C(C)(C)C3)s2)c1 |
| InChI | InChI=1S/C28H32F3N5O4S/c1-15(2)39-21-7-9-33-25(36-21)35-18-11-16(3)10-17(12-18)20-13-34-23(41-20)27(40-24(38)28(29,30)31)8-6-19(22(32)37)26(4,5)14-27/h7,9-13,15,19H,6,8,14H2,1-5H3,(H2,32,37)(H,33,35,36)/t19-,27-/m1/s1 |
| InChIKey | CRMHCMHJYUVUJH-XHCCPWGMSA-N |
| XLogP | 6.05 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.66 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |