About (5-methyl-2-propan-2-ylcyclohexyl) (2S)-2,3-dihydroxypropanoate
(5-methyl-2-propan-2-ylcyclohexyl) (2S)-2,3-dihydroxypropanoate (PubChem CID 67431411) has the molecular formula C13H24O4
and a molecular weight of 244.33 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) (2S)-2,3-dihydroxypropanoate.
Molecular Properties
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) (2S)-2,3-dihydroxypropanoate |
| PubChem CID | 67431411 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) (2S)-2,3-dihydroxypropanoate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)[C@@H](O)CO)C1 |
| InChI | InChI=1S/C13H24O4/c1-8(2)10-5-4-9(3)6-12(10)17-13(16)11(15)7-14/h8-12,14-15H,4-7H2,1-3H3/t9?,10?,11-,12?/m0/s1 |
| InChIKey | OGGGSPWIOLZZJU-FYJQFVIDSA-N |
| XLogP | 1.34 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-methyl-2-propan-2-ylcyclohexyl) (2S)-2,3-dihydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) (2S)-2,3-dihydroxypropanoate?
The IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) (2S)-2,3-dihydroxypropanoate (CID 67431411) is (5-methyl-2-propan-2-ylcyclohexyl) (2S)-2,3-dihydroxypropanoate.
What is the SMILES notation for (5-methyl-2-propan-2-ylcyclohexyl) (2S)-2,3-dihydroxypropanoate?
The canonical SMILES for (5-methyl-2-propan-2-ylcyclohexyl) (2S)-2,3-dihydroxypropanoate is CC1CCC(C(C)C)C(OC(=O)[C@@H](O)CO)C1.
What is the InChIKey of (5-methyl-2-propan-2-ylcyclohexyl) (2S)-2,3-dihydroxypropanoate?
The InChIKey is OGGGSPWIOLZZJU-FYJQFVIDSA-N. The full InChI is InChI=1S/C13H24O4/c1-8(2)10-5-4-9(3)6-12(10)17-13(16)11(15)7-14/h8-12,14-15H,4-7H2,1-3H3/t9?,10?,11-,12?/m0/s1.
What are the key properties of (5-methyl-2-propan-2-ylcyclohexyl) (2S)-2,3-dihydroxypropanoate?
(5-methyl-2-propan-2-ylcyclohexyl) (2S)-2,3-dihydroxypropanoate has a molecular weight of 244.33 g/mol, XLogP of 1.34, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-propan-2-ylcyclohexyl) (2S)-2,3-dihydroxypropanoate is sourced from PubChem (CID 67431411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).