C18H19F3N6O2S2 — CID 67431888
2-[[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]methylamino]ethanesulfonamide (PubChem CID 67431888) has the molecular formula C18H19F3N6O2S2 and a molecular weight of 472.52 g/mol. Its IUPAC name is 2-[[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]methylamino]ethanesulfonamide.
| Compound Name | 2-[[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]methylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 67431888 |
| Molecular Formula | C18H19F3N6O2S2 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 2-[[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]methylamino]ethanesulfonamide |
| SMILES | Cc1cc(Nc2nccc(C(F)(F)F)n2)cc(-c2cnc(CNCCS(N)(=O)=O)s2)c1 |
| InChI | InChI=1S/C18H19F3N6O2S2/c1-11-6-12(14-9-25-16(30-14)10-23-4-5-31(22,28)29)8-13(7-11)26-17-24-3-2-15(27-17)18(19,20)21/h2-3,6-9,23H,4-5,10H2,1H3,(H2,22,28,29)(H,24,26,27) |
| InChIKey | JFJMZLLVAFCURZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|