C23H24F3N7O — CID 67432148
3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]amino]-12-(trifluoromethyl)-2,4,15-triazatricyclo[8.5.0.01,6]pentadeca-2,5,10,12,14-pentaen-8-one (PubChem CID 67432148) has the molecular formula C23H24F3N7O and a molecular weight of 471.49 g/mol. Its IUPAC name is 3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]amino]-12-(trifluoromethyl)-2,4,15-triazatricyclo[8.5.0.01,6]pentadeca-2,5,10,12,14-pentaen-8-one.
| Compound Name | 3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]amino]-12-(trifluoromethyl)-2,4,15-triazatricyclo[8.5.0.01,6]pentadeca-2,5,10,12,14-pentaen-8-one |
|---|---|
| PubChem CID | 67432148 |
| Molecular Formula | C23H24F3N7O |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]amino]-12-(trifluoromethyl)-2,4,15-triazatricyclo[8.5.0.01,6]pentadeca-2,5,10,12,14-pentaen-8-one |
| SMILES | CN1CCN(c2ccc(NC3=NC45N=CC=C(C(F)(F)F)C=C4CC(=O)CC5=CN3)cn2)CC1 |
| InChI | InChI=1S/C23H24F3N7O/c1-32-6-8-33(9-7-32)20-3-2-18(14-27-20)30-21-28-13-17-12-19(34)11-16-10-15(23(24,25)26)4-5-29-22(16,17)31-21/h2-5,10,13-14H,6-9,11-12H2,1H3,(H2,28,30,31) |
| InChIKey | GPVJGOUZIDREPC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |