About (1S)-1-[(2S,5R)-5-aminooxan-2-yl]-2-(6-fluoro-3-methoxyquinoxalin-5-yl)ethanol
(1S)-1-[(2S,5R)-5-aminooxan-2-yl]-2-(6-fluoro-3-methoxyquinoxalin-5-yl)ethanol (PubChem CID 67432163) has the molecular formula C16H20FN3O3
and a molecular weight of 321.35 g/mol. Its IUPAC name is (1S)-1-[(2S,5R)-5-aminooxan-2-yl]-2-(6-fluoro-3-methoxyquinoxalin-5-yl)ethanol.
Molecular Properties
| Compound Name | (1S)-1-[(2S,5R)-5-aminooxan-2-yl]-2-(6-fluoro-3-methoxyquinoxalin-5-yl)ethanol |
| PubChem CID | 67432163 |
| Molecular Formula | C16H20FN3O3 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (1S)-1-[(2S,5R)-5-aminooxan-2-yl]-2-(6-fluoro-3-methoxyquinoxalin-5-yl)ethanol |
| SMILES | COc1cnc2ccc(F)c(C[C@H](O)[C@@H]3CC[C@@H](N)CO3)c2n1 |
| InChI | InChI=1S/C16H20FN3O3/c1-22-15-7-19-12-4-3-11(17)10(16(12)20-15)6-13(21)14-5-2-9(18)8-23-14/h3-4,7,9,13-14,21H,2,5-6,8,18H2,1H3/t9-,13+,14+/m1/s1 |
| InChIKey | BZEBHFTZFJEQCF-IIMNLJJBSA-N |
| XLogP | 1.19 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1S)-1-[(2S,5R)-5-aminooxan-2-yl]-2-(6-fluoro-3-methoxyquinoxalin-5-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[(2S,5R)-5-aminooxan-2-yl]-2-(6-fluoro-3-methoxyquinoxalin-5-yl)ethanol?
The IUPAC name of (1S)-1-[(2S,5R)-5-aminooxan-2-yl]-2-(6-fluoro-3-methoxyquinoxalin-5-yl)ethanol (CID 67432163) is (1S)-1-[(2S,5R)-5-aminooxan-2-yl]-2-(6-fluoro-3-methoxyquinoxalin-5-yl)ethanol.
What is the SMILES notation for (1S)-1-[(2S,5R)-5-aminooxan-2-yl]-2-(6-fluoro-3-methoxyquinoxalin-5-yl)ethanol?
The canonical SMILES for (1S)-1-[(2S,5R)-5-aminooxan-2-yl]-2-(6-fluoro-3-methoxyquinoxalin-5-yl)ethanol is COc1cnc2ccc(F)c(C[C@H](O)[C@@H]3CC[C@@H](N)CO3)c2n1.
What is the InChIKey of (1S)-1-[(2S,5R)-5-aminooxan-2-yl]-2-(6-fluoro-3-methoxyquinoxalin-5-yl)ethanol?
The InChIKey is BZEBHFTZFJEQCF-IIMNLJJBSA-N. The full InChI is InChI=1S/C16H20FN3O3/c1-22-15-7-19-12-4-3-11(17)10(16(12)20-15)6-13(21)14-5-2-9(18)8-23-14/h3-4,7,9,13-14,21H,2,5-6,8,18H2,1H3/t9-,13+,14+/m1/s1.
What are the key properties of (1S)-1-[(2S,5R)-5-aminooxan-2-yl]-2-(6-fluoro-3-methoxyquinoxalin-5-yl)ethanol?
(1S)-1-[(2S,5R)-5-aminooxan-2-yl]-2-(6-fluoro-3-methoxyquinoxalin-5-yl)ethanol has a molecular weight of 321.35 g/mol, XLogP of 1.19, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[(2S,5R)-5-aminooxan-2-yl]-2-(6-fluoro-3-methoxyquinoxalin-5-yl)ethanol is sourced from PubChem (CID 67432163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).