C17H21FN2O3 — CID 67432307
(1S)-1-[(2S,5R)-5-aminooxan-2-yl]-2-(7-fluoro-2-methoxyquinolin-8-yl)ethanol (PubChem CID 67432307) has the molecular formula C17H21FN2O3 and a molecular weight of 320.36 g/mol. Its IUPAC name is (1S)-1-[(2S,5R)-5-aminooxan-2-yl]-2-(7-fluoro-2-methoxyquinolin-8-yl)ethanol.
| Compound Name | (1S)-1-[(2S,5R)-5-aminooxan-2-yl]-2-(7-fluoro-2-methoxyquinolin-8-yl)ethanol |
|---|---|
| PubChem CID | 67432307 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (1S)-1-[(2S,5R)-5-aminooxan-2-yl]-2-(7-fluoro-2-methoxyquinolin-8-yl)ethanol |
| SMILES | COc1ccc2ccc(F)c(C[C@H](O)[C@@H]3CC[C@@H](N)CO3)c2n1 |
| InChI | InChI=1S/C17H21FN2O3/c1-22-16-7-3-10-2-5-13(18)12(17(10)20-16)8-14(21)15-6-4-11(19)9-23-15/h2-3,5,7,11,14-15,21H,4,6,8-9,19H2,1H3/t11-,14+,15+/m1/s1 |
| InChIKey | FBRMCQFVVAIMRX-UGFHNGPFSA-N |
| XLogP | 1.79 |
| TPSA | 77.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |