C22H20FN7O5 — CID 67432501
(4'R,6'S,7'S)-13'-(2-aminopyrimidin-4-yl)-17'-fluoro-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione (PubChem CID 67432501) has the molecular formula C22H20FN7O5 and a molecular weight of 481.44 g/mol. Its IUPAC name is (4'R,6'S,7'S)-13'-(2-aminopyrimidin-4-yl)-17'-fluoro-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione.
| Compound Name | (4'R,6'S,7'S)-13'-(2-aminopyrimidin-4-yl)-17'-fluoro-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
|---|---|
| PubChem CID | 67432501 |
| Molecular Formula | C22H20FN7O5 |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | (4'R,6'S,7'S)-13'-(2-aminopyrimidin-4-yl)-17'-fluoro-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
| SMILES | C[C@@H]1CN2c3c(cc4c(-c5ccnc(N)n5)noc4c3F)CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C22H20FN7O5/c1-8-7-30-15-10(6-22(17(30)9(2)34-8)18(31)27-21(33)28-19(22)32)5-11-14(29-35-16(11)13(15)23)12-3-4-25-20(24)26-12/h3-5,8-9,17H,6-7H2,1-2H3,(H2,24,25,26)(H2,27,28,31,32,33)/t8-,9+,17-/m1/s1 |
| InChIKey | MBCCAHOCJOACSK-KSRUKNBBSA-N |
| XLogP | 0.90 |
| TPSA | 165.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|