C23H20ClN5O5 — CID 67432635
(4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-pyridin-2-ylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione (PubChem CID 67432635) has the molecular formula C23H20ClN5O5 and a molecular weight of 481.90 g/mol. Its IUPAC name is (4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-pyridin-2-ylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione.
| Compound Name | (4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-pyridin-2-ylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
|---|---|
| PubChem CID | 67432635 |
| Molecular Formula | C23H20ClN5O5 |
| Molecular Weight | 481.90 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | (4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-pyridin-2-ylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
| SMILES | C[C@@H]1CN2c3c(cc4c(-c5ccccn5)noc4c3Cl)CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C23H20ClN5O5/c1-10-9-29-17-12(7-13-16(14-5-3-4-6-25-14)28-34-18(13)15(17)24)8-23(19(29)11(2)33-10)20(30)26-22(32)27-21(23)31/h3-7,10-11,19H,8-9H2,1-2H3,(H2,26,27,30,31,32)/t10-,11+,19-/m1/s1 |
| InChIKey | BGTMVPCTKSRAIT-RMDKCXRXSA-N |
| XLogP | 2.43 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.90 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|