C27H31F3N4O3S — CID 67432777
(1S,2R,4R,6S)-2-ethyl-4-hydroxy-1,2,6-trimethyl-4-[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylic acid (PubChem CID 67432777) has the molecular formula C27H31F3N4O3S and a molecular weight of 548.63 g/mol. Its IUPAC name is (1S,2R,4R,6S)-2-ethyl-4-hydroxy-1,2,6-trimethyl-4-[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylic acid.
| Compound Name | (1S,2R,4R,6S)-2-ethyl-4-hydroxy-1,2,6-trimethyl-4-[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 67432777 |
| Molecular Formula | C27H31F3N4O3S |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | (1S,2R,4R,6S)-2-ethyl-4-hydroxy-1,2,6-trimethyl-4-[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylic acid |
| SMILES | CC[C@]1(C)C[C@@](O)(c2ncc(-c3cc(C)cc(Nc4nccc(C(F)(F)F)n4)c3)s2)C[C@H](C)[C@]1(C)C(=O)O |
| InChI | InChI=1S/C27H31F3N4O3S/c1-6-24(4)14-26(37,12-16(3)25(24,5)22(35)36)21-32-13-19(38-21)17-9-15(2)10-18(11-17)33-23-31-8-7-20(34-23)27(28,29)30/h7-11,13,16,37H,6,12,14H2,1-5H3,(H,35,36)(H,31,33,34)/t16-,24+,25+,26+/m0/s1 |
| InChIKey | IBJJJVQATBBCAU-NZTPSJBJSA-N |
| XLogP | 6.80 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |