C21H19FN6O5 — CID 67432962
(4'R,6'S,7'S)-17'-fluoro-13'-imidazol-1-yl-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione (PubChem CID 67432962) has the molecular formula C21H19FN6O5 and a molecular weight of 454.42 g/mol. Its IUPAC name is (4'R,6'S,7'S)-17'-fluoro-13'-imidazol-1-yl-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione.
| Compound Name | (4'R,6'S,7'S)-17'-fluoro-13'-imidazol-1-yl-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
|---|---|
| PubChem CID | 67432962 |
| Molecular Formula | C21H19FN6O5 |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (4'R,6'S,7'S)-17'-fluoro-13'-imidazol-1-yl-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
| SMILES | C[C@@H]1CN2c3c(cc4c(-n5ccnc5)noc4c3F)CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C21H19FN6O5/c1-9-7-28-14-11(5-12-15(13(14)22)33-26-17(12)27-4-3-23-8-27)6-21(16(28)10(2)32-9)18(29)24-20(31)25-19(21)30/h3-5,8-10,16H,6-7H2,1-2H3,(H2,24,25,29,30,31)/t9-,10+,16-/m1/s1 |
| InChIKey | AQJPWQPUBWBDQE-KCWFYHRYSA-N |
| XLogP | 1.04 |
| TPSA | 131.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|