About [3-(1,3-benzoxazole-2-carbonyl)-5-cyclohexyl-2-methyl-6-morpholin-4-yl-6-oxohexyl] carbamate
[3-(1,3-benzoxazole-2-carbonyl)-5-cyclohexyl-2-methyl-6-morpholin-4-yl-6-oxohexyl] carbamate (PubChem CID 67433366) has the molecular formula C26H35N3O6
and a molecular weight of 485.58 g/mol. Its IUPAC name is [3-(1,3-benzoxazole-2-carbonyl)-5-cyclohexyl-2-methyl-6-morpholin-4-yl-6-oxohexyl] carbamate.
Molecular Properties
| Compound Name | [3-(1,3-benzoxazole-2-carbonyl)-5-cyclohexyl-2-methyl-6-morpholin-4-yl-6-oxohexyl] carbamate |
| PubChem CID | 67433366 |
| Molecular Formula | C26H35N3O6 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | [3-(1,3-benzoxazole-2-carbonyl)-5-cyclohexyl-2-methyl-6-morpholin-4-yl-6-oxohexyl] carbamate |
| SMILES | CC(COC(N)=O)C(CC(C(=O)N1CCOCC1)C1CCCCC1)C(=O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C26H35N3O6/c1-17(16-34-26(27)32)19(23(30)24-28-21-9-5-6-10-22(21)35-24)15-20(18-7-3-2-4-8-18)25(31)29-11-13-33-14-12-29/h5-6,9-10,17-20H,2-4,7-8,11-16H2,1H3,(H2,27,32) |
| InChIKey | ZATMBSPVLJNZFC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-(1,3-benzoxazole-2-carbonyl)-5-cyclohexyl-2-methyl-6-morpholin-4-yl-6-oxohexyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,3-benzoxazole-2-carbonyl)-5-cyclohexyl-2-methyl-6-morpholin-4-yl-6-oxohexyl] carbamate?
The IUPAC name of [3-(1,3-benzoxazole-2-carbonyl)-5-cyclohexyl-2-methyl-6-morpholin-4-yl-6-oxohexyl] carbamate (CID 67433366) is [3-(1,3-benzoxazole-2-carbonyl)-5-cyclohexyl-2-methyl-6-morpholin-4-yl-6-oxohexyl] carbamate.
What is the SMILES notation for [3-(1,3-benzoxazole-2-carbonyl)-5-cyclohexyl-2-methyl-6-morpholin-4-yl-6-oxohexyl] carbamate?
The canonical SMILES for [3-(1,3-benzoxazole-2-carbonyl)-5-cyclohexyl-2-methyl-6-morpholin-4-yl-6-oxohexyl] carbamate is CC(COC(N)=O)C(CC(C(=O)N1CCOCC1)C1CCCCC1)C(=O)c1nc2ccccc2o1.
What is the InChIKey of [3-(1,3-benzoxazole-2-carbonyl)-5-cyclohexyl-2-methyl-6-morpholin-4-yl-6-oxohexyl] carbamate?
The InChIKey is ZATMBSPVLJNZFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35N3O6/c1-17(16-34-26(27)32)19(23(30)24-28-21-9-5-6-10-22(21)35-24)15-20(18-7-3-2-4-8-18)25(31)29-11-13-33-14-12-29/h5-6,9-10,17-20H,2-4,7-8,11-16H2,1H3,(H2,27,32).
What are the key properties of [3-(1,3-benzoxazole-2-carbonyl)-5-cyclohexyl-2-methyl-6-morpholin-4-yl-6-oxohexyl] carbamate?
[3-(1,3-benzoxazole-2-carbonyl)-5-cyclohexyl-2-methyl-6-morpholin-4-yl-6-oxohexyl] carbamate has a molecular weight of 485.58 g/mol, XLogP of 3.80, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,3-benzoxazole-2-carbonyl)-5-cyclohexyl-2-methyl-6-morpholin-4-yl-6-oxohexyl] carbamate is sourced from PubChem (CID 67433366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).