C24H22ClN5O5 — CID 67433378
(4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-(6-methyl-3-pyridinyl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione (PubChem CID 67433378) has the molecular formula C24H22ClN5O5 and a molecular weight of 495.92 g/mol. Its IUPAC name is (4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-(6-methyl-3-pyridinyl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione.
| Compound Name | (4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-(6-methyl-3-pyridinyl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
|---|---|
| PubChem CID | 67433378 |
| Molecular Formula | C24H22ClN5O5 |
| Molecular Weight | 495.92 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | (4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-(6-methyl-3-pyridinyl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
| SMILES | Cc1ccc(-c2noc3c(Cl)c4c(cc23)CC2(C(=O)NC(=O)NC2=O)[C@H]2[C@H](C)O[C@H](C)CN42)cn1 |
| InChI | InChI=1S/C24H22ClN5O5/c1-10-4-5-13(8-26-10)17-15-6-14-7-24(21(31)27-23(33)28-22(24)32)20-12(3)34-11(2)9-30(20)18(14)16(25)19(15)35-29-17/h4-6,8,11-12,20H,7,9H2,1-3H3,(H2,27,28,31,32,33)/t11-,12+,20-/m1/s1 |
| InChIKey | MGGQLLPHRYNGJP-XAAFQQQXSA-N |
| XLogP | 2.74 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.92 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|