About tert-butyl 4-(5-amino-1,2-dihydropyridin-2-yl)piperidine-1-carboxylate
tert-butyl 4-(5-amino-1,2-dihydropyridin-2-yl)piperidine-1-carboxylate (PubChem CID 67433663) has the molecular formula C15H25N3O2
and a molecular weight of 279.38 g/mol. Its IUPAC name is tert-butyl 4-(5-amino-1,2-dihydropyridin-2-yl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(5-amino-1,2-dihydropyridin-2-yl)piperidine-1-carboxylate |
| PubChem CID | 67433663 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | tert-butyl 4-(5-amino-1,2-dihydropyridin-2-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C2C=CC(N)=CN2)CC1 |
| InChI | InChI=1S/C15H25N3O2/c1-15(2,3)20-14(19)18-8-6-11(7-9-18)13-5-4-12(16)10-17-13/h4-5,10-11,13,17H,6-9,16H2,1-3H3 |
| InChIKey | AYNOGKIVPLSGSH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-(5-amino-1,2-dihydropyridin-2-yl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(5-amino-1,2-dihydropyridin-2-yl)piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-(5-amino-1,2-dihydropyridin-2-yl)piperidine-1-carboxylate (CID 67433663) is tert-butyl 4-(5-amino-1,2-dihydropyridin-2-yl)piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-(5-amino-1,2-dihydropyridin-2-yl)piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-(5-amino-1,2-dihydropyridin-2-yl)piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(C2C=CC(N)=CN2)CC1.
What is the InChIKey of tert-butyl 4-(5-amino-1,2-dihydropyridin-2-yl)piperidine-1-carboxylate?
The InChIKey is AYNOGKIVPLSGSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O2/c1-15(2,3)20-14(19)18-8-6-11(7-9-18)13-5-4-12(16)10-17-13/h4-5,10-11,13,17H,6-9,16H2,1-3H3.
What are the key properties of tert-butyl 4-(5-amino-1,2-dihydropyridin-2-yl)piperidine-1-carboxylate?
tert-butyl 4-(5-amino-1,2-dihydropyridin-2-yl)piperidine-1-carboxylate has a molecular weight of 279.38 g/mol, XLogP of 1.96, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(5-amino-1,2-dihydropyridin-2-yl)piperidine-1-carboxylate is sourced from PubChem (CID 67433663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).