C34H40O4 — CID 67433757
[2-benzoyloxy-3-cyclohexyl-5-(2,4,4-trimethylpentan-2-yl)phenyl] benzoate (PubChem CID 67433757) has the molecular formula C34H40O4 and a molecular weight of 512.69 g/mol. Its IUPAC name is [2-benzoyloxy-3-cyclohexyl-5-(2,4,4-trimethylpentan-2-yl)phenyl] benzoate.
| Compound Name | [2-benzoyloxy-3-cyclohexyl-5-(2,4,4-trimethylpentan-2-yl)phenyl] benzoate |
|---|---|
| PubChem CID | 67433757 |
| Molecular Formula | C34H40O4 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | [2-benzoyloxy-3-cyclohexyl-5-(2,4,4-trimethylpentan-2-yl)phenyl] benzoate |
| SMILES | CC(C)(C)CC(C)(C)c1cc(OC(=O)c2ccccc2)c(OC(=O)c2ccccc2)c(C2CCCCC2)c1 |
| InChI | InChI=1S/C34H40O4/c1-33(2,3)23-34(4,5)27-21-28(24-15-9-6-10-16-24)30(38-32(36)26-19-13-8-14-20-26)29(22-27)37-31(35)25-17-11-7-12-18-25/h7-8,11-14,17-22,24H,6,9-10,15-16,23H2,1-5H3 |
| InChIKey | WSAOOVXBZTTYBN-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|