C25H23ClN6O6 — CID 67433949
(4'R,6'S,7'S)-N-benzyl-17'-chloro-4',6'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-13'-carboxamide (PubChem CID 67433949) has the molecular formula C25H23ClN6O6 and a molecular weight of 538.95 g/mol. Its IUPAC name is (4'R,6'S,7'S)-N-benzyl-17'-chloro-4',6'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-13'-carboxamide.
| Compound Name | (4'R,6'S,7'S)-N-benzyl-17'-chloro-4',6'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-13'-carboxamide |
|---|---|
| PubChem CID | 67433949 |
| Molecular Formula | C25H23ClN6O6 |
| Molecular Weight | 538.95 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | (4'R,6'S,7'S)-N-benzyl-17'-chloro-4',6'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-13'-carboxamide |
| SMILES | C[C@@H]1CN2c3c(nc4c(C(=O)NCc5ccccc5)noc4c3Cl)CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C25H23ClN6O6/c1-11-10-32-18-14(8-25(20(32)12(2)37-11)22(34)29-24(36)30-23(25)35)28-16-17(31-38-19(16)15(18)26)21(33)27-9-13-6-4-3-5-7-13/h3-7,11-12,20H,8-10H2,1-2H3,(H,27,33)(H2,29,30,34,35,36)/t11-,12+,20-/m1/s1 |
| InChIKey | KVPNHYMKFMNQAA-XAAFQQQXSA-N |
| XLogP | 1.70 |
| TPSA | 155.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.95 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|