C16H22N2 — CID 67433990
11-methyl-1,2,3,4,6,7,7a,8,12b,12c-decahydroindolo[3,2-a]quinolizine (PubChem CID 67433990) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 11-methyl-1,2,3,4,6,7,7a,8,12b,12c-decahydroindolo[3,2-a]quinolizine.
| Compound Name | 11-methyl-1,2,3,4,6,7,7a,8,12b,12c-decahydroindolo[3,2-a]quinolizine |
|---|---|
| PubChem CID | 67433990 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 11-methyl-1,2,3,4,6,7,7a,8,12b,12c-decahydroindolo[3,2-a]quinolizine |
| SMILES | Cc1ccc2c(c1)C1C(CCN3CCCCC13)N2 |
| InChI | InChI=1S/C16H22N2/c1-11-5-6-13-12(10-11)16-14(17-13)7-9-18-8-3-2-4-15(16)18/h5-6,10,14-17H,2-4,7-9H2,1H3 |
| InChIKey | RAMVLMQLZWNAJR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |