About (5-methyl-2-propan-2-ylcyclohexyl) 2,2-dimethyl-1,3-dioxolane-4-carboxylate
(5-methyl-2-propan-2-ylcyclohexyl) 2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 67434133) has the molecular formula C16H28O4
and a molecular weight of 284.40 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2,2-dimethyl-1,3-dioxolane-4-carboxylate.
Molecular Properties
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| PubChem CID | 67434133 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C2COC(C)(C)O2)C1 |
| InChI | InChI=1S/C16H28O4/c1-10(2)12-7-6-11(3)8-13(12)19-15(17)14-9-18-16(4,5)20-14/h10-14H,6-9H2,1-5H3 |
| InChIKey | YKZAHLJUGOWSSE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-methyl-2-propan-2-ylcyclohexyl) 2,2-dimethyl-1,3-dioxolane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) 2,2-dimethyl-1,3-dioxolane-4-carboxylate?
The IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) 2,2-dimethyl-1,3-dioxolane-4-carboxylate (CID 67434133) is (5-methyl-2-propan-2-ylcyclohexyl) 2,2-dimethyl-1,3-dioxolane-4-carboxylate.
What is the SMILES notation for (5-methyl-2-propan-2-ylcyclohexyl) 2,2-dimethyl-1,3-dioxolane-4-carboxylate?
The canonical SMILES for (5-methyl-2-propan-2-ylcyclohexyl) 2,2-dimethyl-1,3-dioxolane-4-carboxylate is CC1CCC(C(C)C)C(OC(=O)C2COC(C)(C)O2)C1.
What is the InChIKey of (5-methyl-2-propan-2-ylcyclohexyl) 2,2-dimethyl-1,3-dioxolane-4-carboxylate?
The InChIKey is YKZAHLJUGOWSSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O4/c1-10(2)12-7-6-11(3)8-13(12)19-15(17)14-9-18-16(4,5)20-14/h10-14H,6-9H2,1-5H3.
What are the key properties of (5-methyl-2-propan-2-ylcyclohexyl) 2,2-dimethyl-1,3-dioxolane-4-carboxylate?
(5-methyl-2-propan-2-ylcyclohexyl) 2,2-dimethyl-1,3-dioxolane-4-carboxylate has a molecular weight of 284.40 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-propan-2-ylcyclohexyl) 2,2-dimethyl-1,3-dioxolane-4-carboxylate is sourced from PubChem (CID 67434133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).