C12H10N6 — CID 67434337
4,6,12,14,15-pentazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2,4,6,10,12,15-heptaen-5-amine (PubChem CID 67434337) has the molecular formula C12H10N6 and a molecular weight of 238.25 g/mol. Its IUPAC name is 4,6,12,14,15-pentazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2,4,6,10,12,15-heptaen-5-amine.
| Compound Name | 4,6,12,14,15-pentazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2,4,6,10,12,15-heptaen-5-amine |
|---|---|
| PubChem CID | 67434337 |
| Molecular Formula | C12H10N6 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 4,6,12,14,15-pentazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2,4,6,10,12,15-heptaen-5-amine |
| SMILES | Nc1ncc2c(n1)CCc1cnc3[nH]ncc3c1-2 |
| InChI | InChI=1S/C12H10N6/c13-12-15-4-7-9(17-12)2-1-6-3-14-11-8(10(6)7)5-16-18-11/h3-5H,1-2H2,(H2,13,15,17)(H,14,16,18) |
| InChIKey | OVFKATPJTPIBAL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |