C25H20Cl2F3NOSi — CID 67434381
2-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalen-1-yl]ethynyl-trimethylsilane (PubChem CID 67434381) has the molecular formula C25H20Cl2F3NOSi and a molecular weight of 506.43 g/mol. Its IUPAC name is 2-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalen-1-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalen-1-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 67434381 |
| Molecular Formula | C25H20Cl2F3NOSi |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | 2-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalen-1-yl]ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#Cc1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)c2ccccc12 |
| InChI | InChI=1S/C25H20Cl2F3NOSi/c1-33(2,3)11-10-16-8-9-22(21-7-5-4-6-20(16)21)23-15-24(32-31-23,25(28,29)30)17-12-18(26)14-19(27)13-17/h4-9,12-14H,15H2,1-3H3 |
| InChIKey | AFLNOAYPSCRLTB-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|