C25H30FN5O5 — CID 67434435
(4'S,6'R,7'R)-13'-(cyclohexylmethylamino)-17'-fluoro-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione (PubChem CID 67434435) has the molecular formula C25H30FN5O5 and a molecular weight of 499.54 g/mol. Its IUPAC name is (4'S,6'R,7'R)-13'-(cyclohexylmethylamino)-17'-fluoro-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione.
| Compound Name | (4'S,6'R,7'R)-13'-(cyclohexylmethylamino)-17'-fluoro-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
|---|---|
| PubChem CID | 67434435 |
| Molecular Formula | C25H30FN5O5 |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | (4'S,6'R,7'R)-13'-(cyclohexylmethylamino)-17'-fluoro-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
| SMILES | C[C@H]1CN2c3c(cc4c(NCC5CCCCC5)noc4c3F)CC3(C(=O)NC(=O)NC3=O)[C@@H]2[C@@H](C)O1 |
| InChI | InChI=1S/C25H30FN5O5/c1-12-11-31-18-15(9-25(20(31)13(2)35-12)22(32)28-24(34)29-23(25)33)8-16-19(17(18)26)36-30-21(16)27-10-14-6-4-3-5-7-14/h8,12-14,20H,3-7,9-11H2,1-2H3,(H,27,30)(H2,28,29,32,33,34)/t12-,13+,20-/m0/s1 |
| InChIKey | WQSIFWPBYFOARZ-RDXCRGQUSA-N |
| XLogP | 2.85 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|