C13H9BrN4S — CID 674355
(7S)-7-(4-bromophenyl)-7,8-dihydro-[1,3]thiazolo[2,3-f]purine (PubChem CID 674355) has the molecular formula C13H9BrN4S and a molecular weight of 333.21 g/mol. Its IUPAC name is (7S)-7-(4-bromophenyl)-7,8-dihydro-[1,3]thiazolo[2,3-f]purine.
| Compound Name | (7S)-7-(4-bromophenyl)-7,8-dihydro-[1,3]thiazolo[2,3-f]purine |
|---|---|
| PubChem CID | 674355 |
| Molecular Formula | C13H9BrN4S |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | (7S)-7-(4-bromophenyl)-7,8-dihydro-[1,3]thiazolo[2,3-f]purine |
| SMILES | Brc1ccc([C@H]2CSc3c4ncnc-4ncn32)cc1 |
| InChI | InChI=1S/C13H9BrN4S/c14-9-3-1-8(2-4-9)10-5-19-13-11-12(16-6-15-11)17-7-18(10)13/h1-4,6-7,10H,5H2/t10-/m1/s1 |
| InChIKey | UPHWMGIYFVPLPH-SNVBAGLBSA-N |
| XLogP | 3.24 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |