C33H40N2O3Si — CID 67436235
(5S)-5-(2,2-dimethyl-1,1-diphenylpropoxy)-6,6-dimethyl-3-[5-(2-trimethylsilylethynyl)-2-pyridinyl]-1,3-oxazinan-2-one (PubChem CID 67436235) has the molecular formula C33H40N2O3Si and a molecular weight of 540.78 g/mol. Its IUPAC name is (5S)-5-(2,2-dimethyl-1,1-diphenylpropoxy)-6,6-dimethyl-3-[5-(2-trimethylsilylethynyl)-2-pyridinyl]-1,3-oxazinan-2-one.
| Compound Name | (5S)-5-(2,2-dimethyl-1,1-diphenylpropoxy)-6,6-dimethyl-3-[5-(2-trimethylsilylethynyl)-2-pyridinyl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 67436235 |
| Molecular Formula | C33H40N2O3Si |
| Molecular Weight | 540.78 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | (5S)-5-(2,2-dimethyl-1,1-diphenylpropoxy)-6,6-dimethyl-3-[5-(2-trimethylsilylethynyl)-2-pyridinyl]-1,3-oxazinan-2-one |
| SMILES | CC1(C)OC(=O)N(c2ccc(C#C[Si](C)(C)C)cn2)C[C@@H]1OC(c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H40N2O3Si/c1-31(2,3)33(26-15-11-9-12-16-26,27-17-13-10-14-18-27)37-28-24-35(30(36)38-32(28,4)5)29-20-19-25(23-34-29)21-22-39(6,7)8/h9-20,23,28H,24H2,1-8H3/t28-/m0/s1 |
| InChIKey | GISNAZDKLRKGOG-NDEPHWFRSA-N |
| XLogP | 7.42 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.78 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|