About 5-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohex-4-ene-1,3-diimine
5-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohex-4-ene-1,3-diimine (PubChem CID 67436441) has the molecular formula C14H15N3
and a molecular weight of 225.30 g/mol. Its IUPAC name is 5-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohex-4-ene-1,3-diimine.
Molecular Properties
| Compound Name | 5-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohex-4-ene-1,3-diimine |
| PubChem CID | 67436441 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 5-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohex-4-ene-1,3-diimine |
| SMILES | [H]/N=C1\C=CC(C=CC2=C/C(=N/[H])C/C(=N\[H])C2)=CC1 |
| InChI | InChI=1S/C14H15N3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-5,7,15-17H,6,8-9H2/b2-1?,15-12+,16-13-,17-14- |
| InChIKey | UQMPLARLOVJVKZ-FNRDTONCSA-N |
| XLogP | 3.21 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohex-4-ene-1,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohex-4-ene-1,3-diimine?
The IUPAC name of 5-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohex-4-ene-1,3-diimine (CID 67436441) is 5-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohex-4-ene-1,3-diimine.
What is the SMILES notation for 5-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohex-4-ene-1,3-diimine?
The canonical SMILES for 5-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohex-4-ene-1,3-diimine is [H]/N=C1\C=CC(C=CC2=C/C(=N/[H])C/C(=N\[H])C2)=CC1.
What is the InChIKey of 5-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohex-4-ene-1,3-diimine?
The InChIKey is UQMPLARLOVJVKZ-FNRDTONCSA-N. The full InChI is InChI=1S/C14H15N3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-5,7,15-17H,6,8-9H2/b2-1?,15-12+,16-13-,17-14-.
What are the key properties of 5-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohex-4-ene-1,3-diimine?
5-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohex-4-ene-1,3-diimine has a molecular weight of 225.30 g/mol, XLogP of 3.21, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohex-4-ene-1,3-diimine is sourced from PubChem (CID 67436441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).