C29H30N6O — CID 67436469
6-cyano-N-[(3R)-1-[(4-cyanophenyl)-[4-[methyl(propan-2-yl)amino]phenyl]methyl]pyrrolidin-3-yl]pyridine-3-carboxamide (PubChem CID 67436469) has the molecular formula C29H30N6O and a molecular weight of 478.60 g/mol. Its IUPAC name is 6-cyano-N-[(3R)-1-[(4-cyanophenyl)-[4-[methyl(propan-2-yl)amino]phenyl]methyl]pyrrolidin-3-yl]pyridine-3-carboxamide.
| Compound Name | 6-cyano-N-[(3R)-1-[(4-cyanophenyl)-[4-[methyl(propan-2-yl)amino]phenyl]methyl]pyrrolidin-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67436469 |
| Molecular Formula | C29H30N6O |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 6-cyano-N-[(3R)-1-[(4-cyanophenyl)-[4-[methyl(propan-2-yl)amino]phenyl]methyl]pyrrolidin-3-yl]pyridine-3-carboxamide |
| SMILES | CC(C)N(C)c1ccc(C(c2ccc(C#N)cc2)N2CC[C@@H](NC(=O)c3ccc(C#N)nc3)C2)cc1 |
| InChI | InChI=1S/C29H30N6O/c1-20(2)34(3)27-12-9-23(10-13-27)28(22-6-4-21(16-30)5-7-22)35-15-14-26(19-35)33-29(36)24-8-11-25(17-31)32-18-24/h4-13,18,20,26,28H,14-15,19H2,1-3H3,(H,33,36)/t26-,28?/m1/s1 |
| InChIKey | DCUFJGXIGDZKCK-HSLSYKTRSA-N |
| XLogP | 4.26 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|