C17H23N3OSi — CID 67436711
1-methyl-3-[5-(2-trimethylsilylethynyl)-2-pyridinyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d]imidazol-2-one (PubChem CID 67436711) has the molecular formula C17H23N3OSi and a molecular weight of 313.48 g/mol. Its IUPAC name is 1-methyl-3-[5-(2-trimethylsilylethynyl)-2-pyridinyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d]imidazol-2-one.
| Compound Name | 1-methyl-3-[5-(2-trimethylsilylethynyl)-2-pyridinyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d]imidazol-2-one |
|---|---|
| PubChem CID | 67436711 |
| Molecular Formula | C17H23N3OSi |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 1-methyl-3-[5-(2-trimethylsilylethynyl)-2-pyridinyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d]imidazol-2-one |
| SMILES | CN1C(=O)N(c2ccc(C#C[Si](C)(C)C)cn2)C2CCCC21 |
| InChI | InChI=1S/C17H23N3OSi/c1-19-14-6-5-7-15(14)20(17(19)21)16-9-8-13(12-18-16)10-11-22(2,3)4/h8-9,12,14-15H,5-7H2,1-4H3 |
| InChIKey | XFNRBUXEONANMX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|