C13H21NO2 — CID 67437244
2,6-dibutoxypyridine (PubChem CID 67437244) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 2,6-dibutoxypyridine.
| Compound Name | 2,6-dibutoxypyridine |
|---|---|
| PubChem CID | 67437244 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 2,6-dibutoxypyridine |
| SMILES | CCCCOc1cccc(OCCCC)n1 |
| InChI | InChI=1S/C13H21NO2/c1-3-5-10-15-12-8-7-9-13(14-12)16-11-6-4-2/h7-9H,3-6,10-11H2,1-2H3 |
| InChIKey | HPKKMIHLGXTUFZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|