C21H31N7OS — CID 67437377
5-amino-N-[5-(4-aminoazepan-1-yl)-1-methylpyrazol-4-yl]-2-cyclohept-2-en-1-yl-1,3-thiazole-4-carboxamide (PubChem CID 67437377) has the molecular formula C21H31N7OS and a molecular weight of 429.59 g/mol. Its IUPAC name is 5-amino-N-[5-(4-aminoazepan-1-yl)-1-methylpyrazol-4-yl]-2-cyclohept-2-en-1-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 5-amino-N-[5-(4-aminoazepan-1-yl)-1-methylpyrazol-4-yl]-2-cyclohept-2-en-1-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 67437377 |
| Molecular Formula | C21H31N7OS |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 5-amino-N-[5-(4-aminoazepan-1-yl)-1-methylpyrazol-4-yl]-2-cyclohept-2-en-1-yl-1,3-thiazole-4-carboxamide |
| SMILES | Cn1ncc(NC(=O)c2nc(C3C=CCCCC3)sc2N)c1N1CCCC(N)CC1 |
| InChI | InChI=1S/C21H31N7OS/c1-27-21(28-11-6-9-15(22)10-12-28)16(13-24-27)25-19(29)17-18(23)30-20(26-17)14-7-4-2-3-5-8-14/h4,7,13-15H,2-3,5-6,8-12,22-23H2,1H3,(H,25,29) |
| InChIKey | DASKFCKQDPOLBG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|