C16H13IN2OS — CID 67437550
2'-iodospiro[5,6-dihydro-1,3-thiazine-4,9'-xanthene]-2-amine (PubChem CID 67437550) has the molecular formula C16H13IN2OS and a molecular weight of 408.26 g/mol. Its IUPAC name is 2'-iodospiro[5,6-dihydro-1,3-thiazine-4,9'-xanthene]-2-amine.
| Compound Name | 2'-iodospiro[5,6-dihydro-1,3-thiazine-4,9'-xanthene]-2-amine |
|---|---|
| PubChem CID | 67437550 |
| Molecular Formula | C16H13IN2OS |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | 2'-iodospiro[5,6-dihydro-1,3-thiazine-4,9'-xanthene]-2-amine |
| SMILES | NC1=NC2(CCS1)c1ccccc1Oc1ccc(I)cc12 |
| InChI | InChI=1S/C16H13IN2OS/c17-10-5-6-14-12(9-10)16(7-8-21-15(18)19-16)11-3-1-2-4-13(11)20-14/h1-6,9H,7-8H2,(H2,18,19) |
| InChIKey | UESOYKMBWRHWOZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|