About 3-bromo-2-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole
3-bromo-2-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole (PubChem CID 67438227) has the molecular formula C12H10BrFN2
and a molecular weight of 281.13 g/mol. Its IUPAC name is 3-bromo-2-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole.
Molecular Properties
| Compound Name | 3-bromo-2-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole |
| PubChem CID | 67438227 |
| Molecular Formula | C12H10BrFN2 |
| Molecular Weight | 281.13 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 3-bromo-2-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole |
| SMILES | Fc1ccccc1-c1nn2c(c1Br)CCC2 |
| InChI | InChI=1S/C12H10BrFN2/c13-11-10-6-3-7-16(10)15-12(11)8-4-1-2-5-9(8)14/h1-2,4-5H,3,6-7H2 |
| InChIKey | UACBGYSYCRTFAM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.13 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-2-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
The IUPAC name of 3-bromo-2-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole (CID 67438227) is 3-bromo-2-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole.
What is the SMILES notation for 3-bromo-2-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
The canonical SMILES for 3-bromo-2-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole is Fc1ccccc1-c1nn2c(c1Br)CCC2.
What is the InChIKey of 3-bromo-2-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
The InChIKey is UACBGYSYCRTFAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrFN2/c13-11-10-6-3-7-16(10)15-12(11)8-4-1-2-5-9(8)14/h1-2,4-5H,3,6-7H2.
What are the key properties of 3-bromo-2-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
3-bromo-2-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole has a molecular weight of 281.13 g/mol, XLogP of 3.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole is sourced from PubChem (CID 67438227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).