C16H17Cl2NO3 — CID 67439161
3-(2,4-dichloro-6-methylphenyl)-8-methoxy-1-azaspiro[4.4]nonane-2,4-dione (PubChem CID 67439161) has the molecular formula C16H17Cl2NO3 and a molecular weight of 342.22 g/mol. Its IUPAC name is 3-(2,4-dichloro-6-methylphenyl)-8-methoxy-1-azaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-(2,4-dichloro-6-methylphenyl)-8-methoxy-1-azaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 67439161 |
| Molecular Formula | C16H17Cl2NO3 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 3-(2,4-dichloro-6-methylphenyl)-8-methoxy-1-azaspiro[4.4]nonane-2,4-dione |
| SMILES | COC1CCC2(C1)NC(=O)C(c1c(C)cc(Cl)cc1Cl)C2=O |
| InChI | InChI=1S/C16H17Cl2NO3/c1-8-5-9(17)6-11(18)12(8)13-14(20)16(19-15(13)21)4-3-10(7-16)22-2/h5-6,10,13H,3-4,7H2,1-2H3,(H,19,21) |
| InChIKey | SDDBSEWOXQFNFT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|