C28H39NO6S — CID 67439671
4-[(1R,14R,16R)-16-methoxy-3-oxo-2,15-dioxabicyclo[12.3.1]octadec-9-en-16-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one (PubChem CID 67439671) has the molecular formula C28H39NO6S and a molecular weight of 517.69 g/mol. Its IUPAC name is 4-[(1R,14R,16R)-16-methoxy-3-oxo-2,15-dioxabicyclo[12.3.1]octadec-9-en-16-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one.
| Compound Name | 4-[(1R,14R,16R)-16-methoxy-3-oxo-2,15-dioxabicyclo[12.3.1]octadec-9-en-16-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 67439671 |
| Molecular Formula | C28H39NO6S |
| Molecular Weight | 517.69 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 4-[(1R,14R,16R)-16-methoxy-3-oxo-2,15-dioxabicyclo[12.3.1]octadec-9-en-16-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one |
| SMILES | COc1ccc(CN2C(=O)SCC2[C@@]2(OC)C[C@H]3C[C@@H](CCCC=CCCCCCC(=O)O3)O2)cc1 |
| InChI | InChI=1S/C28H39NO6S/c1-32-22-15-13-21(14-16-22)19-29-25(20-36-27(29)31)28(33-2)18-24-17-23(35-28)11-9-7-5-3-4-6-8-10-12-26(30)34-24/h3,5,13-16,23-25H,4,6-12,17-20H2,1-2H3/t23-,24-,25?,28-/m1/s1 |
| InChIKey | ZUIDFEWQCVRFJI-RKJZMMCKSA-N |
| XLogP | 5.86 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.69 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|