C22H21BrF2N8O2 — CID 67439762
6-bromo-3-[2-[3-[(2,4-difluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]ethyl]-9-pentyl-[1,2,4]triazolo[4,3-a]purin-5-one (PubChem CID 67439762) has the molecular formula C22H21BrF2N8O2 and a molecular weight of 547.36 g/mol. Its IUPAC name is 6-bromo-3-[2-[3-[(2,4-difluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]ethyl]-9-pentyl-[1,2,4]triazolo[4,3-a]purin-5-one.
| Compound Name | 6-bromo-3-[2-[3-[(2,4-difluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]ethyl]-9-pentyl-[1,2,4]triazolo[4,3-a]purin-5-one |
|---|---|
| PubChem CID | 67439762 |
| Molecular Formula | C22H21BrF2N8O2 |
| Molecular Weight | 547.36 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | 6-bromo-3-[2-[3-[(2,4-difluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]ethyl]-9-pentyl-[1,2,4]triazolo[4,3-a]purin-5-one |
| SMILES | CCCCCn1c2ncn(Br)c2c(=O)n2c(CCc3nc(Cc4ccc(F)cc4F)no3)nnc12 |
| InChI | InChI=1S/C22H21BrF2N8O2/c1-2-3-4-9-31-20-19(32(23)12-26-20)21(34)33-17(28-29-22(31)33)7-8-18-27-16(30-35-18)10-13-5-6-14(24)11-15(13)25/h5-6,11-12H,2-4,7-10H2,1H3 |
| InChIKey | GVOQLXAXVVUDIO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 108.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|