C9H10F4NO5P — CID 67439849
[2-(aminomethyl)-5-fluorophenyl]phosphonic acid;2,2,2-trifluoroacetic acid (PubChem CID 67439849) has the molecular formula C9H10F4NO5P and a molecular weight of 319.15 g/mol. Its IUPAC name is [2-(aminomethyl)-5-fluorophenyl]phosphonic acid;2,2,2-trifluoroacetic acid.
| Compound Name | [2-(aminomethyl)-5-fluorophenyl]phosphonic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67439849 |
| Molecular Formula | C9H10F4NO5P |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | [2-(aminomethyl)-5-fluorophenyl]phosphonic acid;2,2,2-trifluoroacetic acid |
| SMILES | NCc1ccc(F)cc1P(=O)(O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H9FNO3P.C2HF3O2/c8-6-2-1-5(4-9)7(3-6)13(10,11)12;3-2(4,5)1(6)7/h1-3H,4,9H2,(H2,10,11,12);(H,6,7) |
| InChIKey | LXASVGNXCABTEJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|