C15H10BF3N2O4 — CID 67439865
6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-(2,2,2-trifluoroethoxy)pyridine-3-carbonitrile (PubChem CID 67439865) has the molecular formula C15H10BF3N2O4 and a molecular weight of 350.06 g/mol. Its IUPAC name is 6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-(2,2,2-trifluoroethoxy)pyridine-3-carbonitrile.
| Compound Name | 6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-(2,2,2-trifluoroethoxy)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 67439865 |
| Molecular Formula | C15H10BF3N2O4 |
| Molecular Weight | 350.06 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-(2,2,2-trifluoroethoxy)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(Oc2ccc3c(c2)COB3O)nc1OCC(F)(F)F |
| InChI | InChI=1S/C15H10BF3N2O4/c17-15(18,19)8-23-14-9(6-20)1-4-13(21-14)25-11-2-3-12-10(5-11)7-24-16(12)22/h1-5,22H,7-8H2 |
| InChIKey | QANZNIFBQSSYSJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.06 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|