About 1-(benzenesulfonyl)-3-(2,6-difluoro-4-pyridinyl)pyrrolo[2,3-b]pyridine
1-(benzenesulfonyl)-3-(2,6-difluoro-4-pyridinyl)pyrrolo[2,3-b]pyridine (PubChem CID 67440373) has the molecular formula C18H11F2N3O2S
and a molecular weight of 371.37 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-(2,6-difluoro-4-pyridinyl)pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-3-(2,6-difluoro-4-pyridinyl)pyrrolo[2,3-b]pyridine |
| PubChem CID | 67440373 |
| Molecular Formula | C18H11F2N3O2S |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 1-(benzenesulfonyl)-3-(2,6-difluoro-4-pyridinyl)pyrrolo[2,3-b]pyridine |
| SMILES | O=S(=O)(c1ccccc1)n1cc(-c2cc(F)nc(F)c2)c2cccnc21 |
| InChI | InChI=1S/C18H11F2N3O2S/c19-16-9-12(10-17(20)22-16)15-11-23(18-14(15)7-4-8-21-18)26(24,25)13-5-2-1-3-6-13/h1-11H |
| InChIKey | PSPLSMHZKBCKOI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-(benzenesulfonyl)-3-(2,6-difluoro-4-pyridinyl)pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-3-(2,6-difluoro-4-pyridinyl)pyrrolo[2,3-b]pyridine?
The IUPAC name of 1-(benzenesulfonyl)-3-(2,6-difluoro-4-pyridinyl)pyrrolo[2,3-b]pyridine (CID 67440373) is 1-(benzenesulfonyl)-3-(2,6-difluoro-4-pyridinyl)pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 1-(benzenesulfonyl)-3-(2,6-difluoro-4-pyridinyl)pyrrolo[2,3-b]pyridine?
The canonical SMILES for 1-(benzenesulfonyl)-3-(2,6-difluoro-4-pyridinyl)pyrrolo[2,3-b]pyridine is O=S(=O)(c1ccccc1)n1cc(-c2cc(F)nc(F)c2)c2cccnc21.
What is the InChIKey of 1-(benzenesulfonyl)-3-(2,6-difluoro-4-pyridinyl)pyrrolo[2,3-b]pyridine?
The InChIKey is PSPLSMHZKBCKOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11F2N3O2S/c19-16-9-12(10-17(20)22-16)15-11-23(18-14(15)7-4-8-21-18)26(24,25)13-5-2-1-3-6-13/h1-11H.
What are the key properties of 1-(benzenesulfonyl)-3-(2,6-difluoro-4-pyridinyl)pyrrolo[2,3-b]pyridine?
1-(benzenesulfonyl)-3-(2,6-difluoro-4-pyridinyl)pyrrolo[2,3-b]pyridine has a molecular weight of 371.37 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-3-(2,6-difluoro-4-pyridinyl)pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 67440373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).