About 4-[[4,6-difluoro-5-(4-phenylphenyl)-1H-benzimidazol-2-yl]oxy]cyclohexane-1-carboxylic acid
4-[[4,6-difluoro-5-(4-phenylphenyl)-1H-benzimidazol-2-yl]oxy]cyclohexane-1-carboxylic acid (PubChem CID 67440573) has the molecular formula C26H22F2N2O3
and a molecular weight of 448.47 g/mol. Its IUPAC name is 4-[[4,6-difluoro-5-(4-phenylphenyl)-1H-benzimidazol-2-yl]oxy]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[[4,6-difluoro-5-(4-phenylphenyl)-1H-benzimidazol-2-yl]oxy]cyclohexane-1-carboxylic acid |
| PubChem CID | 67440573 |
| Molecular Formula | C26H22F2N2O3 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 4-[[4,6-difluoro-5-(4-phenylphenyl)-1H-benzimidazol-2-yl]oxy]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(Oc2nc3c(F)c(-c4ccc(-c5ccccc5)cc4)c(F)cc3[nH]2)CC1 |
| InChI | InChI=1S/C26H22F2N2O3/c27-20-14-21-24(30-26(29-21)33-19-12-10-18(11-13-19)25(31)32)23(28)22(20)17-8-6-16(7-9-17)15-4-2-1-3-5-15/h1-9,14,18-19H,10-13H2,(H,29,30)(H,31,32) |
| InChIKey | VQFATZDXIHVJSW-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[4,6-difluoro-5-(4-phenylphenyl)-1H-benzimidazol-2-yl]oxy]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4,6-difluoro-5-(4-phenylphenyl)-1H-benzimidazol-2-yl]oxy]cyclohexane-1-carboxylic acid?
The IUPAC name of 4-[[4,6-difluoro-5-(4-phenylphenyl)-1H-benzimidazol-2-yl]oxy]cyclohexane-1-carboxylic acid (CID 67440573) is 4-[[4,6-difluoro-5-(4-phenylphenyl)-1H-benzimidazol-2-yl]oxy]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-[[4,6-difluoro-5-(4-phenylphenyl)-1H-benzimidazol-2-yl]oxy]cyclohexane-1-carboxylic acid?
The canonical SMILES for 4-[[4,6-difluoro-5-(4-phenylphenyl)-1H-benzimidazol-2-yl]oxy]cyclohexane-1-carboxylic acid is O=C(O)C1CCC(Oc2nc3c(F)c(-c4ccc(-c5ccccc5)cc4)c(F)cc3[nH]2)CC1.
What is the InChIKey of 4-[[4,6-difluoro-5-(4-phenylphenyl)-1H-benzimidazol-2-yl]oxy]cyclohexane-1-carboxylic acid?
The InChIKey is VQFATZDXIHVJSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22F2N2O3/c27-20-14-21-24(30-26(29-21)33-19-12-10-18(11-13-19)25(31)32)23(28)22(20)17-8-6-16(7-9-17)15-4-2-1-3-5-15/h1-9,14,18-19H,10-13H2,(H,29,30)(H,31,32).
What are the key properties of 4-[[4,6-difluoro-5-(4-phenylphenyl)-1H-benzimidazol-2-yl]oxy]cyclohexane-1-carboxylic acid?
4-[[4,6-difluoro-5-(4-phenylphenyl)-1H-benzimidazol-2-yl]oxy]cyclohexane-1-carboxylic acid has a molecular weight of 448.47 g/mol, XLogP of 6.20, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4,6-difluoro-5-(4-phenylphenyl)-1H-benzimidazol-2-yl]oxy]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 67440573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).