About 4-azatricyclo[6.2.2.02,7]dodec-1-ene
4-azatricyclo[6.2.2.02,7]dodec-1-ene (PubChem CID 67440690) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 4-azatricyclo[6.2.2.02,7]dodec-1-ene.
Molecular Properties
| Compound Name | 4-azatricyclo[6.2.2.02,7]dodec-1-ene |
| PubChem CID | 67440690 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 4-azatricyclo[6.2.2.02,7]dodec-1-ene |
| SMILES | C1CC2C(=C3CCC2CC3)CN1 |
| InChI | InChI=1S/C11H17N/c1-3-9-4-2-8(1)10-5-6-12-7-11(9)10/h8,10,12H,1-7H2 |
| InChIKey | MNQOTWSVNIVDTE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-azatricyclo[6.2.2.02,7]dodec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azatricyclo[6.2.2.02,7]dodec-1-ene?
The IUPAC name of 4-azatricyclo[6.2.2.02,7]dodec-1-ene (CID 67440690) is 4-azatricyclo[6.2.2.02,7]dodec-1-ene.
What is the SMILES notation for 4-azatricyclo[6.2.2.02,7]dodec-1-ene?
The canonical SMILES for 4-azatricyclo[6.2.2.02,7]dodec-1-ene is C1CC2C(=C3CCC2CC3)CN1.
What is the InChIKey of 4-azatricyclo[6.2.2.02,7]dodec-1-ene?
The InChIKey is MNQOTWSVNIVDTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-3-9-4-2-8(1)10-5-6-12-7-11(9)10/h8,10,12H,1-7H2.
What are the key properties of 4-azatricyclo[6.2.2.02,7]dodec-1-ene?
4-azatricyclo[6.2.2.02,7]dodec-1-ene has a molecular weight of 163.26 g/mol, XLogP of 2.10, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azatricyclo[6.2.2.02,7]dodec-1-ene is sourced from PubChem (CID 67440690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).