About 2-pyridin-4-ylpyrazolo[5,1-b][1,3]thiazole
2-pyridin-4-ylpyrazolo[5,1-b][1,3]thiazole (PubChem CID 67440723) has the molecular formula C10H7N3S
and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-pyridin-4-ylpyrazolo[5,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | 2-pyridin-4-ylpyrazolo[5,1-b][1,3]thiazole |
| PubChem CID | 67440723 |
| Molecular Formula | C10H7N3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 2-pyridin-4-ylpyrazolo[5,1-b][1,3]thiazole |
| SMILES | c1cc(-c2cn3nccc3s2)ccn1 |
| InChI | InChI=1S/C10H7N3S/c1-4-11-5-2-8(1)9-7-13-10(14-9)3-6-12-13/h1-7H |
| InChIKey | FGFZBUNPZWCCGV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-pyridin-4-ylpyrazolo[5,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-4-ylpyrazolo[5,1-b][1,3]thiazole?
The IUPAC name of 2-pyridin-4-ylpyrazolo[5,1-b][1,3]thiazole (CID 67440723) is 2-pyridin-4-ylpyrazolo[5,1-b][1,3]thiazole.
What is the SMILES notation for 2-pyridin-4-ylpyrazolo[5,1-b][1,3]thiazole?
The canonical SMILES for 2-pyridin-4-ylpyrazolo[5,1-b][1,3]thiazole is c1cc(-c2cn3nccc3s2)ccn1.
What is the InChIKey of 2-pyridin-4-ylpyrazolo[5,1-b][1,3]thiazole?
The InChIKey is FGFZBUNPZWCCGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3S/c1-4-11-5-2-8(1)9-7-13-10(14-9)3-6-12-13/h1-7H.
What are the key properties of 2-pyridin-4-ylpyrazolo[5,1-b][1,3]thiazole?
2-pyridin-4-ylpyrazolo[5,1-b][1,3]thiazole has a molecular weight of 201.25 g/mol, XLogP of 2.46, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-4-ylpyrazolo[5,1-b][1,3]thiazole is sourced from PubChem (CID 67440723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).