About [(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-methoxy-3-phenylpropyl] carbamate
[(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-methoxy-3-phenylpropyl] carbamate (PubChem CID 67440849) has the molecular formula C15H19NO4
and a molecular weight of 277.32 g/mol. Its IUPAC name is [(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-methoxy-3-phenylpropyl] carbamate.
Molecular Properties
| Compound Name | [(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-methoxy-3-phenylpropyl] carbamate |
| PubChem CID | 67440849 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | [(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-methoxy-3-phenylpropyl] carbamate |
| SMILES | CO[C@](COC(N)=O)(Cc1ccccc1)[C@@H]1C=CCO1 |
| InChI | InChI=1S/C15H19NO4/c1-18-15(11-20-14(16)17,13-8-5-9-19-13)10-12-6-3-2-4-7-12/h2-8,13H,9-11H2,1H3,(H2,16,17)/t13-,15-/m0/s1 |
| InChIKey | AYEIWLOYQLRBKO-ZFWWWQNUSA-N |
| XLogP | 1.66 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-methoxy-3-phenylpropyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-methoxy-3-phenylpropyl] carbamate?
The IUPAC name of [(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-methoxy-3-phenylpropyl] carbamate (CID 67440849) is [(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-methoxy-3-phenylpropyl] carbamate.
What is the SMILES notation for [(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-methoxy-3-phenylpropyl] carbamate?
The canonical SMILES for [(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-methoxy-3-phenylpropyl] carbamate is CO[C@](COC(N)=O)(Cc1ccccc1)[C@@H]1C=CCO1.
What is the InChIKey of [(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-methoxy-3-phenylpropyl] carbamate?
The InChIKey is AYEIWLOYQLRBKO-ZFWWWQNUSA-N. The full InChI is InChI=1S/C15H19NO4/c1-18-15(11-20-14(16)17,13-8-5-9-19-13)10-12-6-3-2-4-7-12/h2-8,13H,9-11H2,1H3,(H2,16,17)/t13-,15-/m0/s1.
What are the key properties of [(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-methoxy-3-phenylpropyl] carbamate?
[(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-methoxy-3-phenylpropyl] carbamate has a molecular weight of 277.32 g/mol, XLogP of 1.66, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-methoxy-3-phenylpropyl] carbamate is sourced from PubChem (CID 67440849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).