About methyl 2-(3-bromophenyl)-8-fluoro-4-hydroxy-3,3-dimethyl-2,4-dihydro-1H-quinoline-7-carboxylate
methyl 2-(3-bromophenyl)-8-fluoro-4-hydroxy-3,3-dimethyl-2,4-dihydro-1H-quinoline-7-carboxylate (PubChem CID 67442199) has the molecular formula C19H19BrFNO3
and a molecular weight of 408.27 g/mol. Its IUPAC name is methyl 2-(3-bromophenyl)-8-fluoro-4-hydroxy-3,3-dimethyl-2,4-dihydro-1H-quinoline-7-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(3-bromophenyl)-8-fluoro-4-hydroxy-3,3-dimethyl-2,4-dihydro-1H-quinoline-7-carboxylate |
| PubChem CID | 67442199 |
| Molecular Formula | C19H19BrFNO3 |
| Molecular Weight | 408.27 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | methyl 2-(3-bromophenyl)-8-fluoro-4-hydroxy-3,3-dimethyl-2,4-dihydro-1H-quinoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1F)NC(c1cccc(Br)c1)C(C)(C)C2O |
| InChI | InChI=1S/C19H19BrFNO3/c1-19(2)16(10-5-4-6-11(20)9-10)22-15-13(17(19)23)8-7-12(14(15)21)18(24)25-3/h4-9,16-17,22-23H,1-3H3 |
| InChIKey | SOISBIZHUAYCKA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.27 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(3-bromophenyl)-8-fluoro-4-hydroxy-3,3-dimethyl-2,4-dihydro-1H-quinoline-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3-bromophenyl)-8-fluoro-4-hydroxy-3,3-dimethyl-2,4-dihydro-1H-quinoline-7-carboxylate?
The IUPAC name of methyl 2-(3-bromophenyl)-8-fluoro-4-hydroxy-3,3-dimethyl-2,4-dihydro-1H-quinoline-7-carboxylate (CID 67442199) is methyl 2-(3-bromophenyl)-8-fluoro-4-hydroxy-3,3-dimethyl-2,4-dihydro-1H-quinoline-7-carboxylate.
What is the SMILES notation for methyl 2-(3-bromophenyl)-8-fluoro-4-hydroxy-3,3-dimethyl-2,4-dihydro-1H-quinoline-7-carboxylate?
The canonical SMILES for methyl 2-(3-bromophenyl)-8-fluoro-4-hydroxy-3,3-dimethyl-2,4-dihydro-1H-quinoline-7-carboxylate is COC(=O)c1ccc2c(c1F)NC(c1cccc(Br)c1)C(C)(C)C2O.
What is the InChIKey of methyl 2-(3-bromophenyl)-8-fluoro-4-hydroxy-3,3-dimethyl-2,4-dihydro-1H-quinoline-7-carboxylate?
The InChIKey is SOISBIZHUAYCKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19BrFNO3/c1-19(2)16(10-5-4-6-11(20)9-10)22-15-13(17(19)23)8-7-12(14(15)21)18(24)25-3/h4-9,16-17,22-23H,1-3H3.
What are the key properties of methyl 2-(3-bromophenyl)-8-fluoro-4-hydroxy-3,3-dimethyl-2,4-dihydro-1H-quinoline-7-carboxylate?
methyl 2-(3-bromophenyl)-8-fluoro-4-hydroxy-3,3-dimethyl-2,4-dihydro-1H-quinoline-7-carboxylate has a molecular weight of 408.27 g/mol, XLogP of 4.60, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-bromophenyl)-8-fluoro-4-hydroxy-3,3-dimethyl-2,4-dihydro-1H-quinoline-7-carboxylate is sourced from PubChem (CID 67442199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).