About 1-[2-(2,2-diethoxyethyl)cyclopentyl]-3,3-dimethylbutan-1-one
1-[2-(2,2-diethoxyethyl)cyclopentyl]-3,3-dimethylbutan-1-one (PubChem CID 67442584) has the molecular formula C17H32O3
and a molecular weight of 284.44 g/mol. Its IUPAC name is 1-[2-(2,2-diethoxyethyl)cyclopentyl]-3,3-dimethylbutan-1-one.
Molecular Properties
| Compound Name | 1-[2-(2,2-diethoxyethyl)cyclopentyl]-3,3-dimethylbutan-1-one |
| PubChem CID | 67442584 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 1-[2-(2,2-diethoxyethyl)cyclopentyl]-3,3-dimethylbutan-1-one |
| SMILES | CCOC(CC1CCCC1C(=O)CC(C)(C)C)OCC |
| InChI | InChI=1S/C17H32O3/c1-6-19-16(20-7-2)11-13-9-8-10-14(13)15(18)12-17(3,4)5/h13-14,16H,6-12H2,1-5H3 |
| InChIKey | WAZZHWQWEHQKCG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(2,2-diethoxyethyl)cyclopentyl]-3,3-dimethylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,2-diethoxyethyl)cyclopentyl]-3,3-dimethylbutan-1-one?
The IUPAC name of 1-[2-(2,2-diethoxyethyl)cyclopentyl]-3,3-dimethylbutan-1-one (CID 67442584) is 1-[2-(2,2-diethoxyethyl)cyclopentyl]-3,3-dimethylbutan-1-one.
What is the SMILES notation for 1-[2-(2,2-diethoxyethyl)cyclopentyl]-3,3-dimethylbutan-1-one?
The canonical SMILES for 1-[2-(2,2-diethoxyethyl)cyclopentyl]-3,3-dimethylbutan-1-one is CCOC(CC1CCCC1C(=O)CC(C)(C)C)OCC.
What is the InChIKey of 1-[2-(2,2-diethoxyethyl)cyclopentyl]-3,3-dimethylbutan-1-one?
The InChIKey is WAZZHWQWEHQKCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O3/c1-6-19-16(20-7-2)11-13-9-8-10-14(13)15(18)12-17(3,4)5/h13-14,16H,6-12H2,1-5H3.
What are the key properties of 1-[2-(2,2-diethoxyethyl)cyclopentyl]-3,3-dimethylbutan-1-one?
1-[2-(2,2-diethoxyethyl)cyclopentyl]-3,3-dimethylbutan-1-one has a molecular weight of 284.44 g/mol, XLogP of 4.20, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,2-diethoxyethyl)cyclopentyl]-3,3-dimethylbutan-1-one is sourced from PubChem (CID 67442584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).